About 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one
1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one (PubChem CID 24962008) has the molecular formula C19H30N2O2S
and a molecular weight of 350.53 g/mol. Its IUPAC name is 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one.
Molecular Properties
| Compound Name | 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one |
| PubChem CID | 24962008 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCc2sc(OC3CCN(C(C)C)CC3)cc2C1 |
| InChI | InChI=1S/C19H30N2O2S/c1-4-5-18(22)21-11-8-17-15(13-21)12-19(24-17)23-16-6-9-20(10-7-16)14(2)3/h12,14,16H,4-11,13H2,1-3H3 |
| InChIKey | FNKNRAWTVVKRLM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one?
The IUPAC name of 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one (CID 24962008) is 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one.
What is the SMILES notation for 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one?
The canonical SMILES for 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one is CCCC(=O)N1CCc2sc(OC3CCN(C(C)C)CC3)cc2C1.
What is the InChIKey of 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one?
The InChIKey is FNKNRAWTVVKRLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O2S/c1-4-5-18(22)21-11-8-17-15(13-21)12-19(24-17)23-16-6-9-20(10-7-16)14(2)3/h12,14,16H,4-11,13H2,1-3H3.
What are the key properties of 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one?
1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one has a molecular weight of 350.53 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1-propan-2-ylpiperidin-4-yl)oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]butan-1-one is sourced from PubChem (CID 24962008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).