C27H24F4N4O — CID 24962382
2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-[1-[3-(methylamino)propyl]indol-3-yl]ethanol (PubChem CID 24962382) has the molecular formula C27H24F4N4O and a molecular weight of 496.51 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-[1-[3-(methylamino)propyl]indol-3-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-[1-[3-(methylamino)propyl]indol-3-yl]ethanol |
|---|---|
| PubChem CID | 24962382 |
| Molecular Formula | C27H24F4N4O |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-[1-[3-(methylamino)propyl]indol-3-yl]ethanol |
| SMILES | CNCCCn1cc(C(O)(c2ccc3c(cnn3-c3ccc(F)cc3)c2)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C27H24F4N4O/c1-32-13-4-14-34-17-23(22-5-2-3-6-25(22)34)26(36,27(29,30)31)19-7-12-24-18(15-19)16-33-35(24)21-10-8-20(28)9-11-21/h2-3,5-12,15-17,32,36H,4,13-14H2,1H3 |
| InChIKey | HEPJUKPUFGZDPT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 55.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|