C20H25N7O4S — CID 24962580
4-[3-[[4-(cyclopropylamino)-3-methylsulfonyl-2H-pyrazolo[3,4-d]pyrimidin-6-yl]amino]phenoxy]-N-methylbutanamide (PubChem CID 24962580) has the molecular formula C20H25N7O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 4-[3-[[4-(cyclopropylamino)-3-methylsulfonyl-2H-pyrazolo[3,4-d]pyrimidin-6-yl]amino]phenoxy]-N-methylbutanamide.
| Compound Name | 4-[3-[[4-(cyclopropylamino)-3-methylsulfonyl-2H-pyrazolo[3,4-d]pyrimidin-6-yl]amino]phenoxy]-N-methylbutanamide |
|---|---|
| PubChem CID | 24962580 |
| Molecular Formula | C20H25N7O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-[3-[[4-(cyclopropylamino)-3-methylsulfonyl-2H-pyrazolo[3,4-d]pyrimidin-6-yl]amino]phenoxy]-N-methylbutanamide |
| SMILES | CNC(=O)CCCOc1cccc(Nc2nc(NC3CC3)c3c(S(C)(=O)=O)[nH]nc3n2)c1 |
| InChI | InChI=1S/C20H25N7O4S/c1-21-15(28)7-4-10-31-14-6-3-5-13(11-14)23-20-24-17(22-12-8-9-12)16-18(25-20)26-27-19(16)32(2,29)30/h3,5-6,11-12H,4,7-10H2,1-2H3,(H,21,28)(H3,22,23,24,25,26,27) |
| InChIKey | HCAAMAMYLFYIDP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 150.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|