C29H21F4N5O — CID 24962742
2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-[1-prop-2-enyl-6-(1H-pyrazol-5-yl)indol-3-yl]ethanol (PubChem CID 24962742) has the molecular formula C29H21F4N5O and a molecular weight of 531.51 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-[1-prop-2-enyl-6-(1H-pyrazol-5-yl)indol-3-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-[1-prop-2-enyl-6-(1H-pyrazol-5-yl)indol-3-yl]ethanol |
|---|---|
| PubChem CID | 24962742 |
| Molecular Formula | C29H21F4N5O |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-[1-prop-2-enyl-6-(1H-pyrazol-5-yl)indol-3-yl]ethanol |
| SMILES | C=CCn1cc(C(O)(c2ccc3c(cnn3-c3ccc(F)cc3)c2)C(F)(F)F)c2ccc(-c3ccn[nH]3)cc21 |
| InChI | InChI=1S/C29H21F4N5O/c1-2-13-37-17-24(23-9-3-18(15-27(23)37)25-11-12-34-36-25)28(39,29(31,32)33)20-4-10-26-19(14-20)16-35-38(26)22-7-5-21(30)6-8-22/h2-12,14-17,39H,1,13H2,(H,34,36) |
| InChIKey | XEGNCYLWAUJTTL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 71.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|