C19H22O5 — CID 24963007
(3R)-3-hydroxy-1-[(1R,6Z)-3-oxo-1,4,5,8-tetrahydro-2-benzoxecin-1-yl]hexane-1,5-dione (PubChem CID 24963007) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[(1R,6Z)-3-oxo-1,4,5,8-tetrahydro-2-benzoxecin-1-yl]hexane-1,5-dione.
| Compound Name | (3R)-3-hydroxy-1-[(1R,6Z)-3-oxo-1,4,5,8-tetrahydro-2-benzoxecin-1-yl]hexane-1,5-dione |
|---|---|
| PubChem CID | 24963007 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (3R)-3-hydroxy-1-[(1R,6Z)-3-oxo-1,4,5,8-tetrahydro-2-benzoxecin-1-yl]hexane-1,5-dione |
| SMILES | CC(=O)C[C@@H](O)CC(=O)[C@@H]1OC(=O)CC/C=C\Cc2ccccc21 |
| InChI | InChI=1S/C19H22O5/c1-13(20)11-15(21)12-17(22)19-16-9-6-5-8-14(16)7-3-2-4-10-18(23)24-19/h2-3,5-6,8-9,15,19,21H,4,7,10-12H2,1H3/b3-2-/t15-,19-/m1/s1 |
| InChIKey | LBRGXKIEUSFACK-MMBVMTPSSA-N |
| XLogP | 2.46 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|