C19H24N2O2S2 — CID 2496313
(1S)-6,7-dimethoxy-N-propan-2-yl-1-thiophen-2-yl-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 2496313) has the molecular formula C19H24N2O2S2 and a molecular weight of 376.55 g/mol. Its IUPAC name is (1S)-6,7-dimethoxy-N-propan-2-yl-1-thiophen-2-yl-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | (1S)-6,7-dimethoxy-N-propan-2-yl-1-thiophen-2-yl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 2496313 |
| Molecular Formula | C19H24N2O2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (1S)-6,7-dimethoxy-N-propan-2-yl-1-thiophen-2-yl-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1cccs1)N(C(=S)NC(C)C)CC2 |
| InChI | InChI=1S/C19H24N2O2S2/c1-12(2)20-19(24)21-8-7-13-10-15(22-3)16(23-4)11-14(13)18(21)17-6-5-9-25-17/h5-6,9-12,18H,7-8H2,1-4H3,(H,20,24)/t18-/m0/s1 |
| InChIKey | QQLNMDAPIDVWLK-SFHVURJKSA-N |
| XLogP | 4.00 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|