C13H18N2O — CID 24963287
(4S)-4-[(2R)-2-phenylbutyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 24963287) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (4S)-4-[(2R)-2-phenylbutyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[(2R)-2-phenylbutyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 24963287 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (4S)-4-[(2R)-2-phenylbutyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CC[C@H](C[C@H]1COC(N)=N1)c1ccccc1 |
| InChI | InChI=1S/C13H18N2O/c1-2-10(11-6-4-3-5-7-11)8-12-9-16-13(14)15-12/h3-7,10,12H,2,8-9H2,1H3,(H2,14,15)/t10-,12+/m1/s1 |
| InChIKey | IXDKFUBXESWHSL-PWSUYJOCSA-N |
| XLogP | 2.28 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |