C22H15FN2O3 — CID 24963516
5-fluoro-4-oxo-1-[(4-pyridin-3-ylphenyl)methyl]quinoline-3-carboxylic acid (PubChem CID 24963516) has the molecular formula C22H15FN2O3 and a molecular weight of 374.37 g/mol. Its IUPAC name is 5-fluoro-4-oxo-1-[(4-pyridin-3-ylphenyl)methyl]quinoline-3-carboxylic acid.
| Compound Name | 5-fluoro-4-oxo-1-[(4-pyridin-3-ylphenyl)methyl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 24963516 |
| Molecular Formula | C22H15FN2O3 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 5-fluoro-4-oxo-1-[(4-pyridin-3-ylphenyl)methyl]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2ccc(-c3cccnc3)cc2)c2cccc(F)c2c1=O |
| InChI | InChI=1S/C22H15FN2O3/c23-18-4-1-5-19-20(18)21(26)17(22(27)28)13-25(19)12-14-6-8-15(9-7-14)16-3-2-10-24-11-16/h1-11,13H,12H2,(H,27,28) |
| InChIKey | RWAHKTYMXPBNIM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |