C13H17FN2O — CID 24963630
(4S)-4-[2-(3-fluorophenyl)butyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 24963630) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is (4S)-4-[2-(3-fluorophenyl)butyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[2-(3-fluorophenyl)butyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 24963630 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | (4S)-4-[2-(3-fluorophenyl)butyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCC(C[C@H]1COC(N)=N1)c1cccc(F)c1 |
| InChI | InChI=1S/C13H17FN2O/c1-2-9(7-12-8-17-13(15)16-12)10-4-3-5-11(14)6-10/h3-6,9,12H,2,7-8H2,1H3,(H2,15,16)/t9?,12-/m0/s1 |
| InChIKey | PYKKVOQNJFGGGD-ACGXKRRESA-N |
| XLogP | 2.42 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |