C24H18N4O2S — CID 24963945
[3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-(5-thiophen-2-yl-3-pyridinyl)methanone (PubChem CID 24963945) has the molecular formula C24H18N4O2S and a molecular weight of 426.50 g/mol. Its IUPAC name is [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-(5-thiophen-2-yl-3-pyridinyl)methanone.
| Compound Name | [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-(5-thiophen-2-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 24963945 |
| Molecular Formula | C24H18N4O2S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [3-(2-hydroxyphenyl)-5-pyridin-3-yl-3,4-dihydropyrazol-2-yl]-(5-thiophen-2-yl-3-pyridinyl)methanone |
| SMILES | O=C(c1cncc(-c2cccs2)c1)N1N=C(c2cccnc2)CC1c1ccccc1O |
| InChI | InChI=1S/C24H18N4O2S/c29-22-7-2-1-6-19(22)21-12-20(16-5-3-9-25-13-16)27-28(21)24(30)18-11-17(14-26-15-18)23-8-4-10-31-23/h1-11,13-15,21,29H,12H2 |
| InChIKey | GWUQEBWTNKRESH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|