C26H38F5NO2 — CID 24963976
2-[(2S,3R)-4,4-difluoro-1-[(4R)-2,2,7,7-tetramethyloctan-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid (PubChem CID 24963976) has the molecular formula C26H38F5NO2 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-[(2S,3R)-4,4-difluoro-1-[(4R)-2,2,7,7-tetramethyloctan-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(2S,3R)-4,4-difluoro-1-[(4R)-2,2,7,7-tetramethyloctan-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 24963976 |
| Molecular Formula | C26H38F5NO2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 2-[(2S,3R)-4,4-difluoro-1-[(4R)-2,2,7,7-tetramethyloctan-4-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
| SMILES | CC(C)(C)CC[C@H](CC(C)(C)C)N1CCC(F)(F)[C@H](CC(=O)O)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H38F5NO2/c1-23(2,3)12-11-19(16-24(4,5)6)32-14-13-25(27,28)20(15-21(33)34)22(32)17-7-9-18(10-8-17)26(29,30)31/h7-10,19-20,22H,11-16H2,1-6H3,(H,33,34)/t19-,20-,22?/m1/s1 |
| InChIKey | OXBCAMJZFBRGRI-JLMWTWJWSA-N |
| XLogP | 7.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |