C27H40F5NO2 — CID 24964339
2-[(2S,3R)-4,4-difluoro-1-(2,2,8,8-tetramethylnonan-5-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid (PubChem CID 24964339) has the molecular formula C27H40F5NO2 and a molecular weight of 505.61 g/mol. Its IUPAC name is 2-[(2S,3R)-4,4-difluoro-1-(2,2,8,8-tetramethylnonan-5-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(2S,3R)-4,4-difluoro-1-(2,2,8,8-tetramethylnonan-5-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 24964339 |
| Molecular Formula | C27H40F5NO2 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 2-[(2S,3R)-4,4-difluoro-1-(2,2,8,8-tetramethylnonan-5-yl)-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
| SMILES | CC(C)(C)CCC(CCC(C)(C)C)N1CCC(F)(F)[C@H](CC(=O)O)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H40F5NO2/c1-24(2,3)13-11-20(12-14-25(4,5)6)33-16-15-26(28,29)21(17-22(34)35)23(33)18-7-9-19(10-8-18)27(30,31)32/h7-10,20-21,23H,11-17H2,1-6H3,(H,34,35)/t21-,23?/m1/s1 |
| InChIKey | FVXGRULBLMVTDG-FKHAVUOCSA-N |
| XLogP | 8.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |