C28H42F5NO2 — CID 24964340
2-[(2S,3R)-4,4-difluoro-1-[(5S)-2,2,9,9-tetramethyldecan-5-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid (PubChem CID 24964340) has the molecular formula C28H42F5NO2 and a molecular weight of 519.64 g/mol. Its IUPAC name is 2-[(2S,3R)-4,4-difluoro-1-[(5S)-2,2,9,9-tetramethyldecan-5-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(2S,3R)-4,4-difluoro-1-[(5S)-2,2,9,9-tetramethyldecan-5-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 24964340 |
| Molecular Formula | C28H42F5NO2 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | 2-[(2S,3R)-4,4-difluoro-1-[(5S)-2,2,9,9-tetramethyldecan-5-yl]-2-[4-(trifluoromethyl)phenyl]piperidin-3-yl]acetic acid |
| SMILES | CC(C)(C)CCC[C@@H](CCC(C)(C)C)N1CCC(F)(F)[C@H](CC(=O)O)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H42F5NO2/c1-25(2,3)14-7-8-21(13-15-26(4,5)6)34-17-16-27(29,30)22(18-23(35)36)24(34)19-9-11-20(12-10-19)28(31,32)33/h9-12,21-22,24H,7-8,13-18H2,1-6H3,(H,35,36)/t21-,22+,24?/m0/s1 |
| InChIKey | IFQDVEXEHSLCAP-JCVDRHSJSA-N |
| XLogP | 8.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |