C24H29F2N5O3 — CID 24964707
7-(2,4-difluorophenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one (PubChem CID 24964707) has the molecular formula C24H29F2N5O3 and a molecular weight of 473.52 g/mol. Its IUPAC name is 7-(2,4-difluorophenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one.
| Compound Name | 7-(2,4-difluorophenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one |
|---|---|
| PubChem CID | 24964707 |
| Molecular Formula | C24H29F2N5O3 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 7-(2,4-difluorophenyl)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-(2-propoxyethyl)pyrido[3,4-b]pyrazin-2-one |
| SMILES | CCCOCCn1c(=O)c(N2CCN(CCO)CC2)nc2cnc(-c3ccc(F)cc3F)cc21 |
| InChI | InChI=1S/C24H29F2N5O3/c1-2-12-34-13-10-31-22-15-20(18-4-3-17(25)14-19(18)26)27-16-21(22)28-23(24(31)33)30-7-5-29(6-8-30)9-11-32/h3-4,14-16,32H,2,5-13H2,1H3 |
| InChIKey | OXNAGYXWQOFMEG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|