C28H31FN4O4 — CID 24965121
tert-butyl 2-[5-[4-[(4-fluorophenyl)methoxy]-2-oxo-1-pyridinyl]-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 24965121) has the molecular formula C28H31FN4O4 and a molecular weight of 506.58 g/mol. Its IUPAC name is tert-butyl 2-[5-[4-[(4-fluorophenyl)methoxy]-2-oxo-1-pyridinyl]-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[5-[4-[(4-fluorophenyl)methoxy]-2-oxo-1-pyridinyl]-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 24965121 |
| Molecular Formula | C28H31FN4O4 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | tert-butyl 2-[5-[4-[(4-fluorophenyl)methoxy]-2-oxo-1-pyridinyl]-2-pyridinyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(c3ccc(-n4ccc(OCc5ccc(F)cc5)cc4=O)cn3)CC2C1 |
| InChI | InChI=1S/C28H31FN4O4/c1-28(2,3)37-27(35)32-16-20-14-31(15-21(20)17-32)25-9-8-23(13-30-25)33-11-10-24(12-26(33)34)36-18-19-4-6-22(29)7-5-19/h4-13,20-21H,14-18H2,1-3H3 |
| InChIKey | SYPXVYDICIPALM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |