C27H39N3O3 — CID 24965354
N-methyl-1-[2-[4-[2-(oxane-4-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]phenyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 24965354) has the molecular formula C27H39N3O3 and a molecular weight of 453.63 g/mol. Its IUPAC name is N-methyl-1-[2-[4-[2-(oxane-4-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]phenyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | N-methyl-1-[2-[4-[2-(oxane-4-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]phenyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24965354 |
| Molecular Formula | C27H39N3O3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | N-methyl-1-[2-[4-[2-(oxane-4-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]phenyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1CCc1ccc(C2CCC3CN(C(=O)C4CCOCC4)CC32)cc1 |
| InChI | InChI=1S/C27H39N3O3/c1-28-26(31)25-3-2-13-29(25)14-10-19-4-6-20(7-5-19)23-9-8-22-17-30(18-24(22)23)27(32)21-11-15-33-16-12-21/h4-7,21-25H,2-3,8-18H2,1H3,(H,28,31) |
| InChIKey | MQCCZJMCMRAWIF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |