About 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane
2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane (PubChem CID 24965570) has the molecular formula C11H13BFIO3
and a molecular weight of 349.94 g/mol. Its IUPAC name is 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane.
Molecular Properties
| Compound Name | 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane |
| PubChem CID | 24965570 |
| Molecular Formula | C11H13BFIO3 |
| Molecular Weight | 349.94 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane |
| SMILES | Fc1ccc(I)c(COB2OCCCCO2)c1 |
| InChI | InChI=1S/C11H13BFIO3/c13-10-3-4-11(14)9(7-10)8-17-12-15-5-1-2-6-16-12/h3-4,7H,1-2,5-6,8H2 |
| InChIKey | SCWBLFWWWFBQAJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane?
The IUPAC name of 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane (CID 24965570) is 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane.
What is the SMILES notation for 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane?
The canonical SMILES for 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane is Fc1ccc(I)c(COB2OCCCCO2)c1.
What is the InChIKey of 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane?
The InChIKey is SCWBLFWWWFBQAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BFIO3/c13-10-3-4-11(14)9(7-10)8-17-12-15-5-1-2-6-16-12/h3-4,7H,1-2,5-6,8H2.
What are the key properties of 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane?
2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane has a molecular weight of 349.94 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-fluoro-2-iodophenyl)methoxy]-1,3,2-dioxaborepane is sourced from PubChem (CID 24965570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).