C34H35N5O4 — CID 24965605
2-[3-[2-[2-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]ethylamino]ethylamino]propyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 24965605) has the molecular formula C34H35N5O4 and a molecular weight of 577.69 g/mol. Its IUPAC name is 2-[3-[2-[2-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]ethylamino]ethylamino]propyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[3-[2-[2-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]ethylamino]ethylamino]propyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 24965605 |
| Molecular Formula | C34H35N5O4 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 2-[3-[2-[2-[3-(1,3-dioxobenzo[de]isoquinolin-2-yl)propylamino]ethylamino]ethylamino]propyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCCNCCNCCNCCCN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C34H35N5O4/c40-31-25-11-1-7-23-8-2-12-26(29(23)25)32(41)38(31)21-5-15-35-17-19-37-20-18-36-16-6-22-39-33(42)27-13-3-9-24-10-4-14-28(30(24)27)34(39)43/h1-4,7-14,35-37H,5-6,15-22H2 |
| InChIKey | SCTQSPKGLHYWMF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|