C15H12FIN4O2 — CID 24965727
5-(2-fluoro-4-iodoanilino)-3,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 24965727) has the molecular formula C15H12FIN4O2 and a molecular weight of 426.19 g/mol. Its IUPAC name is 5-(2-fluoro-4-iodoanilino)-3,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-fluoro-4-iodoanilino)-3,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24965727 |
| Molecular Formula | C15H12FIN4O2 |
| Molecular Weight | 426.19 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 5-(2-fluoro-4-iodoanilino)-3,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cn1cnc2c(c(Nc3ccc(I)cc3F)cc(=O)n2C)c1=O |
| InChI | InChI=1S/C15H12FIN4O2/c1-20-7-18-14-13(15(20)23)11(6-12(22)21(14)2)19-10-4-3-8(17)5-9(10)16/h3-7,19H,1-2H3 |
| InChIKey | KZRPLGCWNHYBDB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|