About [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate
[4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate (PubChem CID 24965911) has the molecular formula C16H13BF4O6S
and a molecular weight of 420.15 g/mol. Its IUPAC name is [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate |
| PubChem CID | 24965911 |
| Molecular Formula | C16H13BF4O6S |
| Molecular Weight | 420.15 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(F)cc1COB1OCC(c2ccccc2)O1)C(F)(F)F |
| InChI | InChI=1S/C16H13BF4O6S/c18-13-6-7-14(27-28(22,23)16(19,20)21)12(8-13)9-24-17-25-10-15(26-17)11-4-2-1-3-5-11/h1-8,15H,9-10H2 |
| InChIKey | ICTCMQHSRHSYDX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.15 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate (CID 24965911) is [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc(F)cc1COB1OCC(c2ccccc2)O1)C(F)(F)F.
What is the InChIKey of [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate?
The InChIKey is ICTCMQHSRHSYDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BF4O6S/c18-13-6-7-14(27-28(22,23)16(19,20)21)12(8-13)9-24-17-25-10-15(26-17)11-4-2-1-3-5-11/h1-8,15H,9-10H2.
What are the key properties of [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate?
[4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate has a molecular weight of 420.15 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-fluoro-2-[(4-phenyl-1,3,2-dioxaborolan-2-yl)oxymethyl]phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 24965911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).