C24H23F3N4O3 — CID 24965935
(3E)-1-[(1R)-1-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]methylidene]piperidin-2-one (PubChem CID 24965935) has the molecular formula C24H23F3N4O3 and a molecular weight of 472.47 g/mol. Its IUPAC name is (3E)-1-[(1R)-1-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]methylidene]piperidin-2-one.
| Compound Name | (3E)-1-[(1R)-1-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]methylidene]piperidin-2-one |
|---|---|
| PubChem CID | 24965935 |
| Molecular Formula | C24H23F3N4O3 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | (3E)-1-[(1R)-1-hydroxy-1-(3,4,5-trifluorophenyl)ethyl]-3-[[3-methoxy-4-(3-methyl-1,2,4-triazol-1-yl)phenyl]methylidene]piperidin-2-one |
| SMILES | COc1cc(/C=C2\CCCN([C@](C)(O)c3cc(F)c(F)c(F)c3)C2=O)ccc1-n1cnc(C)n1 |
| InChI | InChI=1S/C24H23F3N4O3/c1-14-28-13-31(29-14)20-7-6-15(10-21(20)34-3)9-16-5-4-8-30(23(16)32)24(2,33)17-11-18(25)22(27)19(26)12-17/h6-7,9-13,33H,4-5,8H2,1-3H3/b16-9+/t24-/m1/s1 |
| InChIKey | UTIFCJFNMBHNQI-BFFNPARHSA-N |
| XLogP | 3.87 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|