C18H18FIN4O4 — CID 24966075
3-[(2R)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)-6,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 24966075) has the molecular formula C18H18FIN4O4 and a molecular weight of 500.27 g/mol. Its IUPAC name is 3-[(2R)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)-6,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 3-[(2R)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)-6,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24966075 |
| Molecular Formula | C18H18FIN4O4 |
| Molecular Weight | 500.27 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 3-[(2R)-2,3-dihydroxypropyl]-5-(2-fluoro-4-iodoanilino)-6,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cc1c(Nc2ccc(I)cc2F)c2c(=O)n(C[C@@H](O)CO)cnc2n(C)c1=O |
| InChI | InChI=1S/C18H18FIN4O4/c1-9-15(22-13-4-3-10(20)5-12(13)19)14-16(23(2)17(9)27)21-8-24(18(14)28)6-11(26)7-25/h3-5,8,11,22,25-26H,6-7H2,1-2H3/t11-/m1/s1 |
| InChIKey | BUNLJQFWCXRHOQ-LLVKDONJSA-N |
| XLogP | 1.24 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|