C24H37N3O — CID 24966134
1-cyclobutyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carboxamide (PubChem CID 24966134) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is 1-cyclobutyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carboxamide.
| Compound Name | 1-cyclobutyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 24966134 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | 1-cyclobutyl-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carboxamide |
| SMILES | CC12CCC(C1)C(C)(C)C2NC(=O)c1nn(C2CCC2)c2c1CCCCCC2 |
| InChI | InChI=1S/C24H37N3O/c1-23(2)16-13-14-24(3,15-16)22(23)25-21(28)20-18-11-6-4-5-7-12-19(18)27(26-20)17-9-8-10-17/h16-17,22H,4-15H2,1-3H3,(H,25,28) |
| InChIKey | ROIJKZKGOOJFJO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |