About 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid
2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid (PubChem CID 24966315) has the molecular formula C22H15FINO6
and a molecular weight of 535.27 g/mol. Its IUPAC name is 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid.
Molecular Properties
| Compound Name | 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid |
| PubChem CID | 24966315 |
| Molecular Formula | C22H15FINO6 |
| Molecular Weight | 535.27 g/mol |
| Exact Mass | 534.99 |
| IUPAC Name | 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)C(F)I)c1C1=C2C=CC(O)=CC2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H15FINO6/c23-20(24)21(28)25-15-3-1-2-14(22(29)30)19(15)18-12-6-4-10(26)8-16(12)31-17-9-11(27)5-7-13(17)18/h1-9,16,20,26-27H,(H,25,28)(H,29,30) |
| InChIKey | ACLJDEKJFVTQNO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid?
The IUPAC name of 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid (CID 24966315) is 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid.
What is the SMILES notation for 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid?
The canonical SMILES for 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid is O=C(O)c1cccc(NC(=O)C(F)I)c1C1=C2C=CC(O)=CC2Oc2cc(O)ccc21.
What is the InChIKey of 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid?
The InChIKey is ACLJDEKJFVTQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15FINO6/c23-20(24)21(28)25-15-3-1-2-14(22(29)30)19(15)18-12-6-4-10(26)8-16(12)31-17-9-11(27)5-7-13(17)18/h1-9,16,20,26-27H,(H,25,28)(H,29,30).
What are the key properties of 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid?
2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid has a molecular weight of 535.27 g/mol, XLogP of 4.33, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dihydroxy-4aH-xanthen-9-yl)-3-[(2-fluoro-2-iodoacetyl)amino]benzoic acid is sourced from PubChem (CID 24966315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).