C17H16FIN4O3 — CID 24966428
5-(2-fluoro-4-iodoanilino)-3-(2-hydroxyethyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 24966428) has the molecular formula C17H16FIN4O3 and a molecular weight of 470.24 g/mol. Its IUPAC name is 5-(2-fluoro-4-iodoanilino)-3-(2-hydroxyethyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-fluoro-4-iodoanilino)-3-(2-hydroxyethyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24966428 |
| Molecular Formula | C17H16FIN4O3 |
| Molecular Weight | 470.24 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 5-(2-fluoro-4-iodoanilino)-3-(2-hydroxyethyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cc1c(Nc2ccc(I)cc2F)c2c(=O)n(CCO)cnc2n(C)c1=O |
| InChI | InChI=1S/C17H16FIN4O3/c1-9-14(21-12-4-3-10(19)7-11(12)18)13-15(22(2)16(9)25)20-8-23(5-6-24)17(13)26/h3-4,7-8,21,24H,5-6H2,1-2H3 |
| InChIKey | BHYRCPCOADFHLX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|