About 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione
1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione (PubChem CID 24966439) has the molecular formula C14H12N2S
and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione.
Molecular Properties
| Compound Name | 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione |
| PubChem CID | 24966439 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione |
| SMILES | S=c1[nH]c(Cc2ccccc2)c2ccccn12 |
| InChI | InChI=1S/C14H12N2S/c17-14-15-12(10-11-6-2-1-3-7-11)13-8-4-5-9-16(13)14/h1-9H,10H2,(H,15,17) |
| InChIKey | GCSNWJVHBGHMFH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione?
The IUPAC name of 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione (CID 24966439) is 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione.
What is the SMILES notation for 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione?
The canonical SMILES for 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione is S=c1[nH]c(Cc2ccccc2)c2ccccn12.
What is the InChIKey of 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione?
The InChIKey is GCSNWJVHBGHMFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2S/c17-14-15-12(10-11-6-2-1-3-7-11)13-8-4-5-9-16(13)14/h1-9H,10H2,(H,15,17).
What are the key properties of 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione?
1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione has a molecular weight of 240.33 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2H-imidazo[1,5-a]pyridine-3-thione is sourced from PubChem (CID 24966439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).