C9H7F3N2O — CID 24966460
(4S)-4-(2,3,5-trifluorophenyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 24966460) has the molecular formula C9H7F3N2O and a molecular weight of 216.16 g/mol. Its IUPAC name is (4S)-4-(2,3,5-trifluorophenyl)-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-(2,3,5-trifluorophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 24966460 |
| Molecular Formula | C9H7F3N2O |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (4S)-4-(2,3,5-trifluorophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=N[C@@H](c2cc(F)cc(F)c2F)CO1 |
| InChI | InChI=1S/C9H7F3N2O/c10-4-1-5(8(12)6(11)2-4)7-3-15-9(13)14-7/h1-2,7H,3H2,(H2,13,14)/t7-/m1/s1 |
| InChIKey | QYYOZCKOLDWQKL-SSDOTTSWSA-N |
| XLogP | 1.49 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|