C19H26FNO2 — CID 24966473
N-cyclopropyl-2-fluoro-N-[4-(2-hydroxyethyl)cyclohexyl]-4-methylbenzamide (PubChem CID 24966473) has the molecular formula C19H26FNO2 and a molecular weight of 319.42 g/mol. Its IUPAC name is N-cyclopropyl-2-fluoro-N-[4-(2-hydroxyethyl)cyclohexyl]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-2-fluoro-N-[4-(2-hydroxyethyl)cyclohexyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 24966473 |
| Molecular Formula | C19H26FNO2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-cyclopropyl-2-fluoro-N-[4-(2-hydroxyethyl)cyclohexyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C2CCC(CCO)CC2)C2CC2)c(F)c1 |
| InChI | InChI=1S/C19H26FNO2/c1-13-2-9-17(18(20)12-13)19(23)21(16-7-8-16)15-5-3-14(4-6-15)10-11-22/h2,9,12,14-16,22H,3-8,10-11H2,1H3 |
| InChIKey | MLINDLLOWXMEEK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |