About N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide
N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide (PubChem CID 24966476) has the molecular formula C18H23F2NO2
and a molecular weight of 323.38 g/mol. Its IUPAC name is N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide |
| PubChem CID | 24966476 |
| Molecular Formula | C18H23F2NO2 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide |
| SMILES | O=C(c1cccc(F)c1F)N(C1CCC(CCO)CC1)C1CC1 |
| InChI | InChI=1S/C18H23F2NO2/c19-16-3-1-2-15(17(16)20)18(23)21(14-8-9-14)13-6-4-12(5-7-13)10-11-22/h1-3,12-14,22H,4-11H2 |
| InChIKey | DOIGTVSNPPUATG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide?
The IUPAC name of N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide (CID 24966476) is N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide.
What is the SMILES notation for N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide?
The canonical SMILES for N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide is O=C(c1cccc(F)c1F)N(C1CCC(CCO)CC1)C1CC1.
What is the InChIKey of N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide?
The InChIKey is DOIGTVSNPPUATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F2NO2/c19-16-3-1-2-15(17(16)20)18(23)21(14-8-9-14)13-6-4-12(5-7-13)10-11-22/h1-3,12-14,22H,4-11H2.
What are the key properties of N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide?
N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide has a molecular weight of 323.38 g/mol, XLogP of 3.51, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2,3-difluoro-N-[4-(2-hydroxyethyl)cyclohexyl]benzamide is sourced from PubChem (CID 24966476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).