C28H35N3O3 — CID 24966612
5-ethynyl-N-[8-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]pyridine-3-carboxamide (PubChem CID 24966612) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 5-ethynyl-N-[8-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]pyridine-3-carboxamide.
| Compound Name | 5-ethynyl-N-[8-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24966612 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 5-ethynyl-N-[8-[1-[4-(2-methoxyethoxy)-2,3-dimethylphenyl]ethyl]-8-azabicyclo[3.2.1]octan-3-yl]pyridine-3-carboxamide |
| SMILES | C#Cc1cncc(C(=O)NC2CC3CCC(C2)N3C(C)c2ccc(OCCOC)c(C)c2C)c1 |
| InChI | InChI=1S/C28H35N3O3/c1-6-21-13-22(17-29-16-21)28(32)30-23-14-24-7-8-25(15-23)31(24)20(4)26-9-10-27(19(3)18(26)2)34-12-11-33-5/h1,9-10,13,16-17,20,23-25H,7-8,11-12,14-15H2,2-5H3,(H,30,32) |
| InChIKey | DCMDGXGFOFZCIQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|