C23H16F2INO6 — CID 24966673
3-[(2,2-difluoro-3-iodopropanoyl)amino]-2-(3,6-dihydroxy-4aH-xanthen-9-yl)benzoic acid (PubChem CID 24966673) has the molecular formula C23H16F2INO6 and a molecular weight of 567.28 g/mol. Its IUPAC name is 3-[(2,2-difluoro-3-iodopropanoyl)amino]-2-(3,6-dihydroxy-4aH-xanthen-9-yl)benzoic acid.
| Compound Name | 3-[(2,2-difluoro-3-iodopropanoyl)amino]-2-(3,6-dihydroxy-4aH-xanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 24966673 |
| Molecular Formula | C23H16F2INO6 |
| Molecular Weight | 567.28 g/mol |
| Exact Mass | 567.00 |
| IUPAC Name | 3-[(2,2-difluoro-3-iodopropanoyl)amino]-2-(3,6-dihydroxy-4aH-xanthen-9-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)C(F)(F)CI)c1C1=C2C=CC(O)=CC2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C23H16F2INO6/c24-23(25,10-26)22(32)27-16-3-1-2-15(21(30)31)20(16)19-13-6-4-11(28)8-17(13)33-18-9-12(29)5-7-14(18)19/h1-9,17,28-29H,10H2,(H,27,32)(H,30,31) |
| InChIKey | BONPYWKYEFOSSB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|