About 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole
1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole (PubChem CID 24966980) has the molecular formula C8H7BO4
and a molecular weight of 177.95 g/mol. Its IUPAC name is 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole.
Molecular Properties
| Compound Name | 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole |
| PubChem CID | 24966980 |
| Molecular Formula | C8H7BO4 |
| Molecular Weight | 177.95 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole |
| SMILES | OB1OCc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C8H7BO4/c10-9-6-2-8-7(11-4-12-8)1-5(6)3-13-9/h1-2,10H,3-4H2 |
| InChIKey | DCUIAAXHLXHQLR-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.95 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole?
The IUPAC name of 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole (CID 24966980) is 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole.
What is the SMILES notation for 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole?
The canonical SMILES for 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole is OB1OCc2cc3c(cc21)OCO3.
What is the InChIKey of 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole?
The InChIKey is DCUIAAXHLXHQLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BO4/c10-9-6-2-8-7(11-4-12-8)1-5(6)3-13-9/h1-2,10H,3-4H2.
What are the key properties of 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole?
1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole has a molecular weight of 177.95 g/mol, XLogP of -0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3H-[1,3]dioxolo[4,5-f][2,1]benzoxaborole is sourced from PubChem (CID 24966980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).