About 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione
1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione (PubChem CID 24967146) has the molecular formula C10H10N2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione.
Molecular Properties
| Compound Name | 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione |
| PubChem CID | 24967146 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione |
| SMILES | C=CCc1[nH]c(=S)n2ccccc12 |
| InChI | InChI=1S/C10H10N2S/c1-2-5-8-9-6-3-4-7-12(9)10(13)11-8/h2-4,6-7H,1,5H2,(H,11,13) |
| InChIKey | FXMHHXVZJFZXLQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione?
The IUPAC name of 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione (CID 24967146) is 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione.
What is the SMILES notation for 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione?
The canonical SMILES for 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione is C=CCc1[nH]c(=S)n2ccccc12.
What is the InChIKey of 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione?
The InChIKey is FXMHHXVZJFZXLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S/c1-2-5-8-9-6-3-4-7-12(9)10(13)11-8/h2-4,6-7H,1,5H2,(H,11,13).
What are the key properties of 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione?
1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione has a molecular weight of 190.27 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-2H-imidazo[1,5-a]pyridine-3-thione is sourced from PubChem (CID 24967146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).