About 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione
1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione (PubChem CID 24967153) has the molecular formula C11H8N2OS
and a molecular weight of 216.27 g/mol. Its IUPAC name is 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione.
Molecular Properties
| Compound Name | 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione |
| PubChem CID | 24967153 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione |
| SMILES | S=c1[nH]c(-c2ccco2)c2ccccn12 |
| InChI | InChI=1S/C11H8N2OS/c15-11-12-10(9-5-3-7-14-9)8-4-1-2-6-13(8)11/h1-7H,(H,12,15) |
| InChIKey | PFUZUVSFNSMPFX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione?
The IUPAC name of 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione (CID 24967153) is 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione.
What is the SMILES notation for 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione?
The canonical SMILES for 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione is S=c1[nH]c(-c2ccco2)c2ccccn12.
What is the InChIKey of 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione?
The InChIKey is PFUZUVSFNSMPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2OS/c15-11-12-10(9-5-3-7-14-9)8-4-1-2-6-13(8)11/h1-7H,(H,12,15).
What are the key properties of 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione?
1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione has a molecular weight of 216.27 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-yl)-2H-imidazo[1,5-a]pyridine-3-thione is sourced from PubChem (CID 24967153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).