C21H30FNO2 — CID 24967560
N-cyclopropyl-2-fluoro-N-[4-(2-hydroxyethyl)cyclohexyl]-4-propan-2-ylbenzamide (PubChem CID 24967560) has the molecular formula C21H30FNO2 and a molecular weight of 347.47 g/mol. Its IUPAC name is N-cyclopropyl-2-fluoro-N-[4-(2-hydroxyethyl)cyclohexyl]-4-propan-2-ylbenzamide.
| Compound Name | N-cyclopropyl-2-fluoro-N-[4-(2-hydroxyethyl)cyclohexyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 24967560 |
| Molecular Formula | C21H30FNO2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | N-cyclopropyl-2-fluoro-N-[4-(2-hydroxyethyl)cyclohexyl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)N(C2CCC(CCO)CC2)C2CC2)c(F)c1 |
| InChI | InChI=1S/C21H30FNO2/c1-14(2)16-5-10-19(20(22)13-16)21(25)23(18-8-9-18)17-6-3-15(4-7-17)11-12-24/h5,10,13-15,17-18,24H,3-4,6-9,11-12H2,1-2H3 |
| InChIKey | IXCSBPUDNGSMPD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |