C13H14F4N2O2 — CID 24967910
(4S)-4-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 24967910) has the molecular formula C13H14F4N2O2 and a molecular weight of 306.26 g/mol. Its IUPAC name is (4S)-4-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 24967910 |
| Molecular Formula | C13H14F4N2O2 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (4S)-4-[2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]ethyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=N[C@@H](CCc2cccc(OC(F)(F)C(F)F)c2)CO1 |
| InChI | InChI=1S/C13H14F4N2O2/c14-11(15)13(16,17)21-10-3-1-2-8(6-10)4-5-9-7-20-12(18)19-9/h1-3,6,9,11H,4-5,7H2,(H2,18,19)/t9-/m0/s1 |
| InChIKey | WSRYMOMUCKVRHO-VIFPVBQESA-N |
| XLogP | 2.57 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|