About 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione
5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 24968231) has the molecular formula C17H16FIN4O3
and a molecular weight of 470.24 g/mol. Its IUPAC name is 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione.
Molecular Properties
| Compound Name | 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
| PubChem CID | 24968231 |
| Molecular Formula | C17H16FIN4O3 |
| Molecular Weight | 470.24 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cn1c(=O)cc(Nc2ccc(I)cc2F)c2c(=O)n(CCCO)cnc21 |
| InChI | InChI=1S/C17H16FIN4O3/c1-22-14(25)8-13(21-12-4-3-10(19)7-11(12)18)15-16(22)20-9-23(17(15)26)5-2-6-24/h3-4,7-9,21,24H,2,5-6H2,1H3 |
| InChIKey | SLEMCKVYWPSXMR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione?
The IUPAC name of 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione (CID 24968231) is 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione.
What is the SMILES notation for 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione?
The canonical SMILES for 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione is Cn1c(=O)cc(Nc2ccc(I)cc2F)c2c(=O)n(CCCO)cnc21.
What is the InChIKey of 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione?
The InChIKey is SLEMCKVYWPSXMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FIN4O3/c1-22-14(25)8-13(21-12-4-3-10(19)7-11(12)18)15-16(22)20-9-23(17(15)26)5-2-6-24/h3-4,7-9,21,24H,2,5-6H2,1H3.
What are the key properties of 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione?
5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione has a molecular weight of 470.24 g/mol, XLogP of 1.96, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoro-4-iodoanilino)-3-(3-hydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione is sourced from PubChem (CID 24968231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).