About N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide
N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide (PubChem CID 24968504) has the molecular formula C18H20ClN3OS
and a molecular weight of 361.90 g/mol. Its IUPAC name is N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide.
Molecular Properties
| Compound Name | N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide |
| PubChem CID | 24968504 |
| Molecular Formula | C18H20ClN3OS |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide |
| SMILES | CCCCN1CC(C)S/C1=N\C(=O)c1cc(Cl)cc2cccnc12 |
| InChI | InChI=1S/C18H20ClN3OS/c1-3-4-8-22-11-12(2)24-18(22)21-17(23)15-10-14(19)9-13-6-5-7-20-16(13)15/h5-7,9-10,12H,3-4,8,11H2,1-2H3/b21-18- |
| InChIKey | JTNCPOFLGVELFG-UZYVYHOESA-N |
| XLogP | 4.62 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide?
The IUPAC name of N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide (CID 24968504) is N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide.
What is the SMILES notation for N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide?
The canonical SMILES for N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide is CCCCN1CC(C)S/C1=N\C(=O)c1cc(Cl)cc2cccnc12.
What is the InChIKey of N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide?
The InChIKey is JTNCPOFLGVELFG-UZYVYHOESA-N. The full InChI is InChI=1S/C18H20ClN3OS/c1-3-4-8-22-11-12(2)24-18(22)21-17(23)15-10-14(19)9-13-6-5-7-20-16(13)15/h5-7,9-10,12H,3-4,8,11H2,1-2H3/b21-18-.
What are the key properties of N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide?
N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide has a molecular weight of 361.90 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-butyl-5-methyl-1,3-thiazolidin-2-ylidene)-6-chloroquinoline-8-carboxamide is sourced from PubChem (CID 24968504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).