C20H16N6O2 — CID 24968580
3-[6-(aminomethyl)imidazo[1,2-a]pyrazin-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 24968580) has the molecular formula C20H16N6O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 3-[6-(aminomethyl)imidazo[1,2-a]pyrazin-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[6-(aminomethyl)imidazo[1,2-a]pyrazin-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 24968580 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3-[6-(aminomethyl)imidazo[1,2-a]pyrazin-3-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3cnc4cnc(CN)cn34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C20H16N6O2/c1-25-10-13(12-4-2-3-5-14(12)25)17-18(20(28)24-19(17)27)15-7-23-16-8-22-11(6-21)9-26(15)16/h2-5,7-10H,6,21H2,1H3,(H,24,27,28) |
| InChIKey | JWUCKOQVJABFIR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|