C30H27N3O3 — CID 24968590
N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-[4-(2-methyl-4-pyridinyl)naphthalen-1-yl]-2-oxoacetamide (PubChem CID 24968590) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-[4-(2-methyl-4-pyridinyl)naphthalen-1-yl]-2-oxoacetamide.
| Compound Name | N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-[4-(2-methyl-4-pyridinyl)naphthalen-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 24968590 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-(5-tert-butyl-3-cyano-2-methoxyphenyl)-2-[4-(2-methyl-4-pyridinyl)naphthalen-1-yl]-2-oxoacetamide |
| SMILES | COc1c(C#N)cc(C(C)(C)C)cc1NC(=O)C(=O)c1ccc(-c2ccnc(C)c2)c2ccccc12 |
| InChI | InChI=1S/C30H27N3O3/c1-18-14-19(12-13-32-18)22-10-11-25(24-9-7-6-8-23(22)24)27(34)29(35)33-26-16-21(30(2,3)4)15-20(17-31)28(26)36-5/h6-16H,1-5H3,(H,33,35) |
| InChIKey | PRULFNBUFLUWHB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|