C27H32FN3O6 — CID 24968777
(3E)-5-fluoro-3-[4-[6-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-3-pyridinyl]-5,5-dimethylfuran-2-ylidene]-1H-indol-2-one (PubChem CID 24968777) has the molecular formula C27H32FN3O6 and a molecular weight of 513.57 g/mol. Its IUPAC name is (3E)-5-fluoro-3-[4-[6-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-3-pyridinyl]-5,5-dimethylfuran-2-ylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-fluoro-3-[4-[6-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-3-pyridinyl]-5,5-dimethylfuran-2-ylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 24968777 |
| Molecular Formula | C27H32FN3O6 |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | (3E)-5-fluoro-3-[4-[6-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethylamino]-3-pyridinyl]-5,5-dimethylfuran-2-ylidene]-1H-indol-2-one |
| SMILES | CC1(C)O/C(=C2/C(=O)Nc3ccc(F)cc32)C=C1c1ccc(NCCOCCOCCOCCO)nc1 |
| InChI | InChI=1S/C27H32FN3O6/c1-27(2)21(16-23(37-27)25-20-15-19(28)4-5-22(20)31-26(25)33)18-3-6-24(30-17-18)29-7-9-34-11-13-36-14-12-35-10-8-32/h3-6,15-17,32H,7-14H2,1-2H3,(H,29,30)(H,31,33)/b25-23+ |
| InChIKey | RXPHXFGUKXHZFQ-WJTDDFOZSA-N |
| XLogP | 3.23 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|