About N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine
N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine (PubChem CID 24968832) has the molecular formula C20H31N3
and a molecular weight of 313.49 g/mol. Its IUPAC name is N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine |
| PubChem CID | 24968832 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine |
| SMILES | CCCN(CCC)CCc1cccc(-c2c(C)nn(C)c2C)c1 |
| InChI | InChI=1S/C20H31N3/c1-6-12-23(13-7-2)14-11-18-9-8-10-19(15-18)20-16(3)21-22(5)17(20)4/h8-10,15H,6-7,11-14H2,1-5H3 |
| InChIKey | UHMTYTVODVLJSQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine?
The IUPAC name of N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine (CID 24968832) is N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine.
What is the SMILES notation for N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine?
The canonical SMILES for N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine is CCCN(CCC)CCc1cccc(-c2c(C)nn(C)c2C)c1.
What is the InChIKey of N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine?
The InChIKey is UHMTYTVODVLJSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3/c1-6-12-23(13-7-2)14-11-18-9-8-10-19(15-18)20-16(3)21-22(5)17(20)4/h8-10,15H,6-7,11-14H2,1-5H3.
What are the key properties of N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine?
N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine has a molecular weight of 313.49 g/mol, XLogP of 4.37, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-N-[2-[3-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethyl]propan-1-amine is sourced from PubChem (CID 24968832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).