C33H54N4O3S — CID 24969144
5-methoxy-2-[(S)-(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-ide;tetrabutylazanium (PubChem CID 24969144) has the molecular formula C33H54N4O3S and a molecular weight of 586.89 g/mol. Its IUPAC name is 5-methoxy-2-[(S)-(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-ide;tetrabutylazanium.
| Compound Name | 5-methoxy-2-[(S)-(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-ide;tetrabutylazanium |
|---|---|
| PubChem CID | 24969144 |
| Molecular Formula | C33H54N4O3S |
| Molecular Weight | 586.89 g/mol |
| Exact Mass | 586.39 |
| IUPAC Name | 5-methoxy-2-[(S)-(4-methoxy-3,5-dimethyl-2-pyridinyl)methylsulfinyl]benzimidazol-1-ide;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.COc1ccc2[n-]c([S@@](=O)Cc3ncc(C)c(OC)c3C)nc2c1 |
| InChI | InChI=1S/C17H18N3O3S.C16H36N/c1-10-8-18-15(11(2)16(10)23-4)9-24(21)17-19-13-6-5-12(22-3)7-14(13)20-17;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h5-8H,9H2,1-4H3;5-16H2,1-4H3/q-1;+1/t24-;/m0./s1 |
| InChIKey | HNYQBFOSHTYAAH-JIDHJSLPSA-N |
| XLogP | 7.53 |
| TPSA | 75.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.89 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|