C19H28N2O2 — CID 2496918
2-(azocan-1-yl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide (PubChem CID 2496918) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 2-(azocan-1-yl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(azocan-1-yl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 2496918 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-(azocan-1-yl)-N-[(2S)-3-oxo-1-phenylbutan-2-yl]acetamide |
| SMILES | CC(=O)[C@H](Cc1ccccc1)NC(=O)CN1CCCCCCC1 |
| InChI | InChI=1S/C19H28N2O2/c1-16(22)18(14-17-10-6-5-7-11-17)20-19(23)15-21-12-8-3-2-4-9-13-21/h5-7,10-11,18H,2-4,8-9,12-15H2,1H3,(H,20,23)/t18-/m0/s1 |
| InChIKey | ZPUJECNISXLLLR-SFHVURJKSA-N |
| XLogP | 2.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |