C16H18N4O5 — CID 2496944
4-[[2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]benzamide (PubChem CID 2496944) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 4-[[2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2496944 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 4-[[2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)acetyl]amino]benzamide |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)Nc2ccc(C(N)=O)cc2)C1=O |
| InChI | InChI=1S/C16H18N4O5/c1-2-3-8-19-14(23)15(24)20(16(19)25)9-12(21)18-11-6-4-10(5-7-11)13(17)22/h4-7H,2-3,8-9H2,1H3,(H2,17,22)(H,18,21) |
| InChIKey | MBMQASDHVQTLIG-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|