C23H27NO5 — CID 24970094
2-methyl-2-[[1-(2-phenoxyethoxy)-5,6,7,8-tetrahydronaphthalene-2-carbonyl]amino]propanoic acid (PubChem CID 24970094) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-methyl-2-[[1-(2-phenoxyethoxy)-5,6,7,8-tetrahydronaphthalene-2-carbonyl]amino]propanoic acid.
| Compound Name | 2-methyl-2-[[1-(2-phenoxyethoxy)-5,6,7,8-tetrahydronaphthalene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 24970094 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-methyl-2-[[1-(2-phenoxyethoxy)-5,6,7,8-tetrahydronaphthalene-2-carbonyl]amino]propanoic acid |
| SMILES | CC(C)(NC(=O)c1ccc2c(c1OCCOc1ccccc1)CCCC2)C(=O)O |
| InChI | InChI=1S/C23H27NO5/c1-23(2,22(26)27)24-21(25)19-13-12-16-8-6-7-11-18(16)20(19)29-15-14-28-17-9-4-3-5-10-17/h3-5,9-10,12-13H,6-8,11,14-15H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | NJOHIVWMBOEAHQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|