C11H18N4O7S3 — CID 24970303
3-[(4R)-4-(ethylamino)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-2-yl]propyl nitrate (PubChem CID 24970303) has the molecular formula C11H18N4O7S3 and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-[(4R)-4-(ethylamino)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-2-yl]propyl nitrate.
| Compound Name | 3-[(4R)-4-(ethylamino)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-2-yl]propyl nitrate |
|---|---|
| PubChem CID | 24970303 |
| Molecular Formula | C11H18N4O7S3 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 3-[(4R)-4-(ethylamino)-1,1-dioxo-6-sulfamoyl-3,4-dihydrothieno[3,2-e]thiazin-2-yl]propyl nitrate |
| SMILES | CCN[C@H]1CN(CCCO[N+](=O)[O-])S(=O)(=O)c2sc(S(N)(=O)=O)cc21 |
| InChI | InChI=1S/C11H18N4O7S3/c1-2-13-9-7-14(4-3-5-22-15(16)17)25(20,21)11-8(9)6-10(23-11)24(12,18)19/h6,9,13H,2-5,7H2,1H3,(H2,12,18,19)/t9-/m0/s1 |
| InChIKey | JUPWVANFVGSJNG-VIFPVBQESA-N |
| XLogP | -0.35 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|