About propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate
propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 24970385) has the molecular formula C15H16N4O2S
and a molecular weight of 316.39 g/mol. Its IUPAC name is propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
Molecular Properties
| Compound Name | propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| PubChem CID | 24970385 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OC(C)C)c1nc2ccc3ncn(CC)c(=O)c3c2s1 |
| InChI | InChI=1S/C15H16N4O2S/c1-4-19-7-17-9-5-6-10-12(11(9)15(19)20)22-14(18-10)13(16)21-8(2)3/h5-8,16H,4H2,1-3H3/b16-13- |
| InChIKey | QJIKOODYNZFJFF-SSZFMOIBSA-N |
| XLogP | 2.78 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The IUPAC name of propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (CID 24970385) is propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
What is the SMILES notation for propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The canonical SMILES for propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate is [H]/N=C(\OC(C)C)c1nc2ccc3ncn(CC)c(=O)c3c2s1.
What is the InChIKey of propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The InChIKey is QJIKOODYNZFJFF-SSZFMOIBSA-N. The full InChI is InChI=1S/C15H16N4O2S/c1-4-19-7-17-9-5-6-10-12(11(9)15(19)20)22-14(18-10)13(16)21-8(2)3/h5-8,16H,4H2,1-3H3/b16-13-.
What are the key properties of propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate has a molecular weight of 316.39 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 8-ethyl-9-oxo-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate is sourced from PubChem (CID 24970385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).