About butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate
butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (PubChem CID 24970433) has the molecular formula C17H20N4O2S
and a molecular weight of 344.44 g/mol. Its IUPAC name is butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
Molecular Properties
| Compound Name | butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| PubChem CID | 24970433 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate |
| SMILES | [H]/N=C(\OCCCC)c1nc2ccc3ncn(C(C)C)c(=O)c3c2s1 |
| InChI | InChI=1S/C17H20N4O2S/c1-4-5-8-23-15(18)16-20-12-7-6-11-13(14(12)24-16)17(22)21(9-19-11)10(2)3/h6-7,9-10,18H,4-5,8H2,1-3H3/b18-15- |
| InChIKey | YYWGDJIEQNZXDR-SDXDJHTJSA-N |
| XLogP | 3.73 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The IUPAC name of butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate (CID 24970433) is butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate.
What is the SMILES notation for butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The canonical SMILES for butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate is [H]/N=C(\OCCCC)c1nc2ccc3ncn(C(C)C)c(=O)c3c2s1.
What is the InChIKey of butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
The InChIKey is YYWGDJIEQNZXDR-SDXDJHTJSA-N. The full InChI is InChI=1S/C17H20N4O2S/c1-4-5-8-23-15(18)16-20-12-7-6-11-13(14(12)24-16)17(22)21(9-19-11)10(2)3/h6-7,9-10,18H,4-5,8H2,1-3H3/b18-15-.
What are the key properties of butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate?
butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate has a molecular weight of 344.44 g/mol, XLogP of 3.73, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidate is sourced from PubChem (CID 24970433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).