About N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide
N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide (PubChem CID 24970435) has the molecular formula C20H19N5OS
and a molecular weight of 377.47 g/mol. Its IUPAC name is N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide.
Molecular Properties
| Compound Name | N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide |
| PubChem CID | 24970435 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide |
| SMILES | CC(C)n1cnc2ccc3nc(/C(N)=N/Cc4ccccc4)sc3c2c1=O |
| InChI | InChI=1S/C20H19N5OS/c1-12(2)25-11-23-14-8-9-15-17(16(14)20(25)26)27-19(24-15)18(21)22-10-13-6-4-3-5-7-13/h3-9,11-12H,10H2,1-2H3,(H2,21,22) |
| InChIKey | AETSHOXDYIPJJZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide?
The IUPAC name of N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide (CID 24970435) is N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide.
What is the SMILES notation for N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide?
The canonical SMILES for N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide is CC(C)n1cnc2ccc3nc(/C(N)=N/Cc4ccccc4)sc3c2c1=O.
What is the InChIKey of N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide?
The InChIKey is AETSHOXDYIPJJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N5OS/c1-12(2)25-11-23-14-8-9-15-17(16(14)20(25)26)27-19(24-15)18(21)22-10-13-6-4-3-5-7-13/h3-9,11-12H,10H2,1-2H3,(H2,21,22).
What are the key properties of N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide?
N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide has a molecular weight of 377.47 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-9-oxo-8-propan-2-yl-[1,3]thiazolo[5,4-f]quinazoline-2-carboximidamide is sourced from PubChem (CID 24970435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).